C26H22N2O5S — CID 135399775
4-hydroxy-5-[7-(3-hydroxy-2-methylpropyl)-1H-indole-3-carbonyl]-3-(1H-indol-3-yl)thiophene-2-carboxylic acid (PubChem CID 135399775) has the molecular formula C26H22N2O5S and a molecular weight of 474.54 g/mol. Its IUPAC name is 4-hydroxy-5-[7-(3-hydroxy-2-methylpropyl)-1H-indole-3-carbonyl]-3-(1H-indol-3-yl)thiophene-2-carboxylic acid.
| Compound Name | 4-hydroxy-5-[7-(3-hydroxy-2-methylpropyl)-1H-indole-3-carbonyl]-3-(1H-indol-3-yl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 135399775 |
| Molecular Formula | C26H22N2O5S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 4-hydroxy-5-[7-(3-hydroxy-2-methylpropyl)-1H-indole-3-carbonyl]-3-(1H-indol-3-yl)thiophene-2-carboxylic acid |
| SMILES | CC(CO)Cc1cccc2c(C(=O)c3sc(C(=O)O)c(-c4c[nH]c5ccccc45)c3O)c[nH]c12 |
| InChI | InChI=1S/C26H22N2O5S/c1-13(12-29)9-14-5-4-7-16-18(11-28-21(14)16)22(30)25-23(31)20(24(34-25)26(32)33)17-10-27-19-8-3-2-6-15(17)19/h2-8,10-11,13,27-29,31H,9,12H2,1H3,(H,32,33) |
| InChIKey | YKYDMWABUMBBRL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|