C25H20N2O5S — CID 135467922
4-hydroxy-5-[7-(3-hydroxypropyl)-1H-indole-3-carbonyl]-3-(1H-indol-3-yl)thiophene-2-carboxylic acid (PubChem CID 135467922) has the molecular formula C25H20N2O5S and a molecular weight of 460.51 g/mol. Its IUPAC name is 4-hydroxy-5-[7-(3-hydroxypropyl)-1H-indole-3-carbonyl]-3-(1H-indol-3-yl)thiophene-2-carboxylic acid.
| Compound Name | 4-hydroxy-5-[7-(3-hydroxypropyl)-1H-indole-3-carbonyl]-3-(1H-indol-3-yl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 135467922 |
| Molecular Formula | C25H20N2O5S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 4-hydroxy-5-[7-(3-hydroxypropyl)-1H-indole-3-carbonyl]-3-(1H-indol-3-yl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc(C(=O)c2c[nH]c3c(CCCO)cccc23)c(O)c1-c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H20N2O5S/c28-10-4-6-13-5-3-8-15-17(12-27-20(13)15)21(29)24-22(30)19(23(33-24)25(31)32)16-11-26-18-9-2-1-7-14(16)18/h1-3,5,7-9,11-12,26-28,30H,4,6,10H2,(H,31,32) |
| InChIKey | ODKZHURPICWTCG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|