C30H25FN2O5S — CID 136658345
3-(2-cyclopropyl-6-fluoro-1H-indol-3-yl)-4-hydroxy-5-[7-(4-hydroxy-3-methylbut-2-enyl)-1H-indole-3-carbonyl]thiophene-2-carboxylic acid (PubChem CID 136658345) has the molecular formula C30H25FN2O5S and a molecular weight of 544.60 g/mol. Its IUPAC name is 3-(2-cyclopropyl-6-fluoro-1H-indol-3-yl)-4-hydroxy-5-[7-(4-hydroxy-3-methylbut-2-enyl)-1H-indole-3-carbonyl]thiophene-2-carboxylic acid.
| Compound Name | 3-(2-cyclopropyl-6-fluoro-1H-indol-3-yl)-4-hydroxy-5-[7-(4-hydroxy-3-methylbut-2-enyl)-1H-indole-3-carbonyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 136658345 |
| Molecular Formula | C30H25FN2O5S |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 3-(2-cyclopropyl-6-fluoro-1H-indol-3-yl)-4-hydroxy-5-[7-(4-hydroxy-3-methylbut-2-enyl)-1H-indole-3-carbonyl]thiophene-2-carboxylic acid |
| SMILES | CC(=CCc1cccc2c(C(=O)c3sc(C(=O)O)c(-c4c(C5CC5)[nH]c5cc(F)ccc45)c3O)c[nH]c12)CO |
| InChI | InChI=1S/C30H25FN2O5S/c1-14(13-34)5-6-15-3-2-4-18-20(12-32-24(15)18)26(35)29-27(36)23(28(39-29)30(37)38)22-19-10-9-17(31)11-21(19)33-25(22)16-7-8-16/h2-5,9-12,16,32-34,36H,6-8,13H2,1H3,(H,37,38) |
| InChIKey | UTWSRVPGJWQXIR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|