C13H15N5O4 — CID 135400600
N-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide (PubChem CID 135400600) has the molecular formula C13H15N5O4 and a molecular weight of 305.29 g/mol. Its IUPAC name is N-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide.
| Compound Name | N-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 135400600 |
| Molecular Formula | C13H15N5O4 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide |
| SMILES | O=C(CN1CCCC1=O)N/C=N/Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H15N5O4/c19-12(8-17-7-1-2-13(17)20)14-9-15-16-10-3-5-11(6-4-10)18(21)22/h3-6,9,16H,1-2,7-8H2,(H,14,15,19) |
| InChIKey | GJZLRKZFRSQVNY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|