C17H15ClN6O2S — CID 135402089
N'-[3-[(2-chlorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-yl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide (PubChem CID 135402089) has the molecular formula C17H15ClN6O2S and a molecular weight of 402.87 g/mol. Its IUPAC name is N'-[3-[(2-chlorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-yl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide.
| Compound Name | N'-[3-[(2-chlorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-yl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide |
|---|---|
| PubChem CID | 135402089 |
| Molecular Formula | C17H15ClN6O2S |
| Molecular Weight | 402.87 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | N'-[3-[(2-chlorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-yl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide |
| SMILES | ON=C(C(=Nc1nc(SCc2ccccc2Cl)n[nH]1)NO)c1ccccc1 |
| InChI | InChI=1S/C17H15ClN6O2S/c18-13-9-5-4-8-12(13)10-27-17-20-16(21-22-17)19-15(24-26)14(23-25)11-6-2-1-3-7-11/h1-9,25-26H,10H2,(H2,19,20,21,22,24) |
| InChIKey | PUZLICKMDKIVFR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 118.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.87 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|