C17H14N4O2S — CID 135402195
N-[2-(3-methylsulfanyl-5-oxo-4H-1,2,4-triazin-6-yl)phenyl]benzamide (PubChem CID 135402195) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is N-[2-(3-methylsulfanyl-5-oxo-4H-1,2,4-triazin-6-yl)phenyl]benzamide.
| Compound Name | N-[2-(3-methylsulfanyl-5-oxo-4H-1,2,4-triazin-6-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 135402195 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | N-[2-(3-methylsulfanyl-5-oxo-4H-1,2,4-triazin-6-yl)phenyl]benzamide |
| SMILES | CSc1nnc(-c2ccccc2NC(=O)c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H14N4O2S/c1-24-17-19-16(23)14(20-21-17)12-9-5-6-10-13(12)18-15(22)11-7-3-2-4-8-11/h2-10H,1H3,(H,18,22)(H,19,21,23) |
| InChIKey | YBTORWXBISWEHX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |