C16H20HgN6O4S+ — CID 135403617
[2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-ylidene]sulfanium;(4-aminophenyl)mercury (PubChem CID 135403617) has the molecular formula C16H20HgN6O4S+ and a molecular weight of 593.03 g/mol. Its IUPAC name is [2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-ylidene]sulfanium;(4-aminophenyl)mercury.
| Compound Name | [2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-ylidene]sulfanium;(4-aminophenyl)mercury |
|---|---|
| PubChem CID | 135403617 |
| Molecular Formula | C16H20HgN6O4S+ |
| Molecular Weight | 593.03 g/mol |
| Exact Mass | 594.10 |
| IUPAC Name | [2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-ylidene]sulfanium;(4-aminophenyl)mercury |
| SMILES | Nc1ccc([Hg])cc1.[H]/[S+]=c1\[nH]c(N)nc2c1ncn2C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C10H13N5O4S.C6H6N.Hg/c11-10-13-7-4(8(20)14-10)12-2-15(7)9-6(18)5(17)3(1-16)19-9;7-6-4-2-1-3-5-6;/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,20);2-5H,7H2;/p+1 |
| InChIKey | JGAZLYOZPUSVQV-UHFFFAOYSA-O |
| XLogP | -1.79 |
| TPSA | 168.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.03 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|