C22H21FN4O2 — CID 135404915
7-[(3-butoxyphenyl)methyl]-2-(2-fluorophenyl)-1H-purin-6-one (PubChem CID 135404915) has the molecular formula C22H21FN4O2 and a molecular weight of 392.43 g/mol. Its IUPAC name is 7-[(3-butoxyphenyl)methyl]-2-(2-fluorophenyl)-1H-purin-6-one.
| Compound Name | 7-[(3-butoxyphenyl)methyl]-2-(2-fluorophenyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135404915 |
| Molecular Formula | C22H21FN4O2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 7-[(3-butoxyphenyl)methyl]-2-(2-fluorophenyl)-1H-purin-6-one |
| SMILES | CCCCOc1cccc(Cn2cnc3nc(-c4ccccc4F)[nH]c(=O)c32)c1 |
| InChI | InChI=1S/C22H21FN4O2/c1-2-3-11-29-16-8-6-7-15(12-16)13-27-14-24-21-19(27)22(28)26-20(25-21)17-9-4-5-10-18(17)23/h4-10,12,14H,2-3,11,13H2,1H3,(H,25,26,28) |
| InChIKey | QVNJSGHRDITTFA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|