C25H28N4O6S — CID 135405589
8,8-dimethyl-2-(3-methylbutylsulfanyl)-5-(6-nitro-1,3-benzodioxol-5-yl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135405589) has the molecular formula C25H28N4O6S and a molecular weight of 512.59 g/mol. Its IUPAC name is 8,8-dimethyl-2-(3-methylbutylsulfanyl)-5-(6-nitro-1,3-benzodioxol-5-yl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 8,8-dimethyl-2-(3-methylbutylsulfanyl)-5-(6-nitro-1,3-benzodioxol-5-yl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135405589 |
| Molecular Formula | C25H28N4O6S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 8,8-dimethyl-2-(3-methylbutylsulfanyl)-5-(6-nitro-1,3-benzodioxol-5-yl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CC(C)CCSc1nc2c(c(=O)[nH]1)C(c1cc3c(cc1[N+](=O)[O-])OCO3)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C25H28N4O6S/c1-12(2)5-6-36-24-27-22-21(23(31)28-24)19(20-14(26-22)9-25(3,4)10-16(20)30)13-7-17-18(35-11-34-17)8-15(13)29(32)33/h7-8,12,19H,5-6,9-11H2,1-4H3,(H2,26,27,28,31) |
| InChIKey | NRKCAXJKBBHXIR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|