C19H12FNO4 — CID 135405807
2-[(4-fluorophenyl)methyl]-1,3-dihydroxybenzo[f]isoindole-4,9-dione (PubChem CID 135405807) has the molecular formula C19H12FNO4 and a molecular weight of 337.31 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-1,3-dihydroxybenzo[f]isoindole-4,9-dione.
| Compound Name | 2-[(4-fluorophenyl)methyl]-1,3-dihydroxybenzo[f]isoindole-4,9-dione |
|---|---|
| PubChem CID | 135405807 |
| Molecular Formula | C19H12FNO4 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-1,3-dihydroxybenzo[f]isoindole-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(O)n(Cc1ccc(F)cc1)c2O |
| InChI | InChI=1S/C19H12FNO4/c20-11-7-5-10(6-8-11)9-21-18(24)14-15(19(21)25)17(23)13-4-2-1-3-12(13)16(14)22/h1-8,24-25H,9H2 |
| InChIKey | XNZRMEVTJFHJGY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|