C25H19F2NO4 — CID 123545873
4-(1,3-dihydroxyisoindol-2-yl)-1-(2-fluoro-6-hydroxyphenyl)-2-(3-fluorophenyl)pent-2-en-1-one (PubChem CID 123545873) has the molecular formula C25H19F2NO4 and a molecular weight of 435.43 g/mol. Its IUPAC name is 4-(1,3-dihydroxyisoindol-2-yl)-1-(2-fluoro-6-hydroxyphenyl)-2-(3-fluorophenyl)pent-2-en-1-one.
| Compound Name | 4-(1,3-dihydroxyisoindol-2-yl)-1-(2-fluoro-6-hydroxyphenyl)-2-(3-fluorophenyl)pent-2-en-1-one |
|---|---|
| PubChem CID | 123545873 |
| Molecular Formula | C25H19F2NO4 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 4-(1,3-dihydroxyisoindol-2-yl)-1-(2-fluoro-6-hydroxyphenyl)-2-(3-fluorophenyl)pent-2-en-1-one |
| SMILES | CC(C=C(C(=O)c1c(O)cccc1F)c1cccc(F)c1)n1c(O)c2ccccc2c1O |
| InChI | InChI=1S/C25H19F2NO4/c1-14(28-24(31)17-8-2-3-9-18(17)25(28)32)12-19(15-6-4-7-16(26)13-15)23(30)22-20(27)10-5-11-21(22)29/h2-14,29,31-32H,1H3 |
| InChIKey | VWTLXSKXMIATMD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|