C31H35N3O7 — CID 135406605
2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[1-(2-hydroxy-6-oxocyclohexen-1-yl)ethylideneamino]hexanoyl]amino]acetic acid (PubChem CID 135406605) has the molecular formula C31H35N3O7 and a molecular weight of 561.64 g/mol. Its IUPAC name is 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[1-(2-hydroxy-6-oxocyclohexen-1-yl)ethylideneamino]hexanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[1-(2-hydroxy-6-oxocyclohexen-1-yl)ethylideneamino]hexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 135406605 |
| Molecular Formula | C31H35N3O7 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[1-(2-hydroxy-6-oxocyclohexen-1-yl)ethylideneamino]hexanoyl]amino]acetic acid |
| SMILES | C/C(=N\CCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCC(=O)O)C1=C(O)CCCC1=O |
| InChI | InChI=1S/C31H35N3O7/c1-19(29-26(35)14-8-15-27(29)36)32-16-7-6-13-25(30(39)33-17-28(37)38)34-31(40)41-18-24-22-11-4-2-9-20(22)21-10-3-5-12-23(21)24/h2-5,9-12,24-25,35H,6-8,13-18H2,1H3,(H,33,39)(H,34,40)(H,37,38)/b32-19+/t25-/m0/s1 |
| InChIKey | GFHWQEIIVMNANO-OWLVZTDXSA-N |
| XLogP | 4.29 |
| TPSA | 154.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|