C21H21ClN2O — CID 135407043
(NZ)-N-[1-[8-(4-chloro-2,6-dimethylphenyl)-2-methylquinolin-4-yl]propylidene]hydroxylamine (PubChem CID 135407043) has the molecular formula C21H21ClN2O and a molecular weight of 352.87 g/mol. Its IUPAC name is (NZ)-N-[1-[8-(4-chloro-2,6-dimethylphenyl)-2-methylquinolin-4-yl]propylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[8-(4-chloro-2,6-dimethylphenyl)-2-methylquinolin-4-yl]propylidene]hydroxylamine |
|---|---|
| PubChem CID | 135407043 |
| Molecular Formula | C21H21ClN2O |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (NZ)-N-[1-[8-(4-chloro-2,6-dimethylphenyl)-2-methylquinolin-4-yl]propylidene]hydroxylamine |
| SMILES | CC/C(=N/O)c1cc(C)nc2c(-c3c(C)cc(Cl)cc3C)cccc12 |
| InChI | InChI=1S/C21H21ClN2O/c1-5-19(24-25)18-11-14(4)23-21-16(18)7-6-8-17(21)20-12(2)9-15(22)10-13(20)3/h6-11,25H,5H2,1-4H3/b24-19- |
| InChIKey | CUNKJKXOLYGCAA-CLCOLTQESA-N |
| XLogP | 6.07 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|