C23H26ClNO — CID 57253961
8-(4-chloro-2,6-dimethylphenyl)-2-methyl-4-pentoxyquinoline (PubChem CID 57253961) has the molecular formula C23H26ClNO and a molecular weight of 367.92 g/mol. Its IUPAC name is 8-(4-chloro-2,6-dimethylphenyl)-2-methyl-4-pentoxyquinoline.
| Compound Name | 8-(4-chloro-2,6-dimethylphenyl)-2-methyl-4-pentoxyquinoline |
|---|---|
| PubChem CID | 57253961 |
| Molecular Formula | C23H26ClNO |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 8-(4-chloro-2,6-dimethylphenyl)-2-methyl-4-pentoxyquinoline |
| SMILES | CCCCCOc1cc(C)nc2c(-c3c(C)cc(Cl)cc3C)cccc12 |
| InChI | InChI=1S/C23H26ClNO/c1-5-6-7-11-26-21-14-17(4)25-23-19(21)9-8-10-20(23)22-15(2)12-18(24)13-16(22)3/h8-10,12-14H,5-7,11H2,1-4H3 |
| InChIKey | UXDHAKUDSCJSIP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|