C19H23ClN4O — CID 57208631
8-(4-chloro-2,6-dimethylphenyl)-2-methyl-4-pentoxypyrazolo[1,5-a][1,3,5]triazine (PubChem CID 57208631) has the molecular formula C19H23ClN4O and a molecular weight of 358.87 g/mol. Its IUPAC name is 8-(4-chloro-2,6-dimethylphenyl)-2-methyl-4-pentoxypyrazolo[1,5-a][1,3,5]triazine.
| Compound Name | 8-(4-chloro-2,6-dimethylphenyl)-2-methyl-4-pentoxypyrazolo[1,5-a][1,3,5]triazine |
|---|---|
| PubChem CID | 57208631 |
| Molecular Formula | C19H23ClN4O |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 8-(4-chloro-2,6-dimethylphenyl)-2-methyl-4-pentoxypyrazolo[1,5-a][1,3,5]triazine |
| SMILES | CCCCCOc1nc(C)nc2c(-c3c(C)cc(Cl)cc3C)cnn12 |
| InChI | InChI=1S/C19H23ClN4O/c1-5-6-7-8-25-19-23-14(4)22-18-16(11-21-24(18)19)17-12(2)9-15(20)10-13(17)3/h9-11H,5-8H2,1-4H3 |
| InChIKey | AEBJTDPKQOVNQV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|