C17H13N3O5S2 — CID 135409083
(1E)-1-[(4-hydroxy-2-oxochromen-3-yl)methylidene]-3-(4-sulfamoylphenyl)thiourea (PubChem CID 135409083) has the molecular formula C17H13N3O5S2 and a molecular weight of 403.44 g/mol. Its IUPAC name is (1E)-1-[(4-hydroxy-2-oxochromen-3-yl)methylidene]-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | (1E)-1-[(4-hydroxy-2-oxochromen-3-yl)methylidene]-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 135409083 |
| Molecular Formula | C17H13N3O5S2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | (1E)-1-[(4-hydroxy-2-oxochromen-3-yl)methylidene]-3-(4-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)/N=C/c2c(O)c3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C17H13N3O5S2/c18-27(23,24)11-7-5-10(6-8-11)20-17(26)19-9-13-15(21)12-3-1-2-4-14(12)25-16(13)22/h1-9,21H,(H,20,26)(H2,18,23,24)/b19-9+ |
| InChIKey | LCHIJPFYWULQMD-DJKKODMXSA-N |
| XLogP | 1.96 |
| TPSA | 134.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|