C17H14N4O4S2 — CID 135409072
(1E)-1-[(4-hydroxy-2-oxo-1H-quinolin-3-yl)methylidene]-3-(4-sulfamoylphenyl)thiourea (PubChem CID 135409072) has the molecular formula C17H14N4O4S2 and a molecular weight of 402.46 g/mol. Its IUPAC name is (1E)-1-[(4-hydroxy-2-oxo-1H-quinolin-3-yl)methylidene]-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | (1E)-1-[(4-hydroxy-2-oxo-1H-quinolin-3-yl)methylidene]-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 135409072 |
| Molecular Formula | C17H14N4O4S2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | (1E)-1-[(4-hydroxy-2-oxo-1H-quinolin-3-yl)methylidene]-3-(4-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)/N=C/c2c(O)c3ccccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H14N4O4S2/c18-27(24,25)11-7-5-10(6-8-11)20-17(26)19-9-13-15(22)12-3-1-2-4-14(12)21-16(13)23/h1-9H,(H,20,26)(H2,18,24,25)(H2,21,22,23)/b19-9+ |
| InChIKey | AWCWWUMOUJHBDD-DJKKODMXSA-N |
| XLogP | 1.70 |
| TPSA | 137.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|