C21H16N2O6 — CID 54704033
6-(4-hydroxy-2-oxo-1H-quinolin-3-yl)-N-(3-hydroxyphenyl)-2,4-dioxohex-5-enamide (PubChem CID 54704033) has the molecular formula C21H16N2O6 and a molecular weight of 392.37 g/mol. Its IUPAC name is 6-(4-hydroxy-2-oxo-1H-quinolin-3-yl)-N-(3-hydroxyphenyl)-2,4-dioxohex-5-enamide.
| Compound Name | 6-(4-hydroxy-2-oxo-1H-quinolin-3-yl)-N-(3-hydroxyphenyl)-2,4-dioxohex-5-enamide |
|---|---|
| PubChem CID | 54704033 |
| Molecular Formula | C21H16N2O6 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 6-(4-hydroxy-2-oxo-1H-quinolin-3-yl)-N-(3-hydroxyphenyl)-2,4-dioxohex-5-enamide |
| SMILES | O=C(C=Cc1c(O)c2ccccc2[nH]c1=O)CC(=O)C(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C21H16N2O6/c24-13-5-3-4-12(10-13)22-21(29)18(26)11-14(25)8-9-16-19(27)15-6-1-2-7-17(15)23-20(16)28/h1-10,24H,11H2,(H,22,29)(H2,23,27,28) |
| InChIKey | XIWXNBKRFZXUMO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|