C16H16N8O4 — CID 135411622
(NZ)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-[4-(5-nitroquinolin-8-yl)piperazin-1-yl]methylidene]hydroxylamine (PubChem CID 135411622) has the molecular formula C16H16N8O4 and a molecular weight of 384.36 g/mol. Its IUPAC name is (NZ)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-[4-(5-nitroquinolin-8-yl)piperazin-1-yl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-[4-(5-nitroquinolin-8-yl)piperazin-1-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135411622 |
| Molecular Formula | C16H16N8O4 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (NZ)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-[4-(5-nitroquinolin-8-yl)piperazin-1-yl]methylidene]hydroxylamine |
| SMILES | Nc1nonc1/C(=N/O)N1CCN(c2ccc([N+](=O)[O-])c3cccnc23)CC1 |
| InChI | InChI=1S/C16H16N8O4/c17-15-14(20-28-21-15)16(19-25)23-8-6-22(7-9-23)12-4-3-11(24(26)27)10-2-1-5-18-13(10)12/h1-5,25H,6-9H2,(H2,17,21)/b19-16- |
| InChIKey | RPIDSAKJSSPTIR-MNDPQUGUSA-N |
| XLogP | 1.07 |
| TPSA | 160.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|