C14H16ClN7O4 — CID 135938349
(NE)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-[(2R)-4-(4-chloro-2-nitrophenyl)-2-methylpiperazin-1-yl]methylidene]hydroxylamine (PubChem CID 135938349) has the molecular formula C14H16ClN7O4 and a molecular weight of 381.78 g/mol. Its IUPAC name is (NE)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-[(2R)-4-(4-chloro-2-nitrophenyl)-2-methylpiperazin-1-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-[(2R)-4-(4-chloro-2-nitrophenyl)-2-methylpiperazin-1-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135938349 |
| Molecular Formula | C14H16ClN7O4 |
| Molecular Weight | 381.78 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (NE)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-[(2R)-4-(4-chloro-2-nitrophenyl)-2-methylpiperazin-1-yl]methylidene]hydroxylamine |
| SMILES | C[C@@H]1CN(c2ccc(Cl)cc2[N+](=O)[O-])CCN1/C(=N/O)c1nonc1N |
| InChI | InChI=1S/C14H16ClN7O4/c1-8-7-20(10-3-2-9(15)6-11(10)22(24)25)4-5-21(8)14(17-23)12-13(16)19-26-18-12/h2-3,6,8,23H,4-5,7H2,1H3,(H2,16,19)/b17-14+/t8-/m1/s1 |
| InChIKey | NNRKAJUUXFMTHC-GERUYDHFSA-N |
| XLogP | 1.56 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.78 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|