C14H17N7O4 — CID 135821947
(NE)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-[2-methyl-4-(4-nitrophenyl)piperazin-1-yl]methylidene]hydroxylamine (PubChem CID 135821947) has the molecular formula C14H17N7O4 and a molecular weight of 347.34 g/mol. Its IUPAC name is (NE)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-[2-methyl-4-(4-nitrophenyl)piperazin-1-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-[2-methyl-4-(4-nitrophenyl)piperazin-1-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135821947 |
| Molecular Formula | C14H17N7O4 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (NE)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-[2-methyl-4-(4-nitrophenyl)piperazin-1-yl]methylidene]hydroxylamine |
| SMILES | CC1CN(c2ccc([N+](=O)[O-])cc2)CCN1/C(=N/O)c1nonc1N |
| InChI | InChI=1S/C14H17N7O4/c1-9-8-19(10-2-4-11(5-3-10)21(23)24)6-7-20(9)14(16-22)12-13(15)18-25-17-12/h2-5,9,22H,6-8H2,1H3,(H2,15,18)/b16-14+ |
| InChIKey | OQZVAHOVGVWQFB-JQIJEIRASA-N |
| XLogP | 0.91 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|