C18H16ClF2N3O3 — CID 7083797
(2-chloro-4,5-difluorophenyl)-[(2S)-2-methyl-4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 7083797) has the molecular formula C18H16ClF2N3O3 and a molecular weight of 395.79 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-[(2S)-2-methyl-4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | (2-chloro-4,5-difluorophenyl)-[(2S)-2-methyl-4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 7083797 |
| Molecular Formula | C18H16ClF2N3O3 |
| Molecular Weight | 395.79 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-[(2S)-2-methyl-4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | C[C@H]1CN(c2ccc([N+](=O)[O-])cc2)CCN1C(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C18H16ClF2N3O3/c1-11-10-22(12-2-4-13(5-3-12)24(26)27)6-7-23(11)18(25)14-8-16(20)17(21)9-15(14)19/h2-5,8-9,11H,6-7,10H2,1H3/t11-/m0/s1 |
| InChIKey | JSINWULXYRTFQS-NSHDSACASA-N |
| XLogP | 3.88 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|