C12H10N6O — CID 135412141
5-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2H-1,2,4-triazin-3-one (PubChem CID 135412141) has the molecular formula C12H10N6O and a molecular weight of 254.25 g/mol. Its IUPAC name is 5-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2H-1,2,4-triazin-3-one.
| Compound Name | 5-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 135412141 |
| Molecular Formula | C12H10N6O |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 5-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2H-1,2,4-triazin-3-one |
| SMILES | O=c1nc(N/N=C/c2c[nH]c3ccccc23)cn[nH]1 |
| InChI | InChI=1S/C12H10N6O/c19-12-16-11(7-15-18-12)17-14-6-8-5-13-10-4-2-1-3-9(8)10/h1-7,13H,(H2,16,17,18,19)/b14-6+ |
| InChIKey | JQUAQHYLLUDFFE-MKMNVTDBSA-N |
| XLogP | 1.09 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|