C22H28NO6- — CID 135412409
2-[[2-(3,4-diethoxyphenyl)-1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylidene]amino]acetate (PubChem CID 135412409) has the molecular formula C22H28NO6- and a molecular weight of 402.47 g/mol. Its IUPAC name is 2-[[2-(3,4-diethoxyphenyl)-1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylidene]amino]acetate.
| Compound Name | 2-[[2-(3,4-diethoxyphenyl)-1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylidene]amino]acetate |
|---|---|
| PubChem CID | 135412409 |
| Molecular Formula | C22H28NO6- |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-[[2-(3,4-diethoxyphenyl)-1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylidene]amino]acetate |
| SMILES | CCOc1ccc(C/C(=N\CC(=O)[O-])C2=C(O)CC(C)(C)CC2=O)cc1OCC |
| InChI | InChI=1S/C22H29NO6/c1-5-28-18-8-7-14(10-19(18)29-6-2)9-15(23-13-20(26)27)21-16(24)11-22(3,4)12-17(21)25/h7-8,10,24H,5-6,9,11-13H2,1-4H3,(H,26,27)/p-1/b23-15+ |
| InChIKey | YQKIFNJHWQPEIK-HZHRSRAPSA-M |
| XLogP | 2.42 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|