C23H33NO4 — CID 7120460
2-[2-(3,4-diethoxyphenyl)acetyl]-5,5-dimethyl-3-propyliminocyclohexan-1-one (PubChem CID 7120460) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is 2-[2-(3,4-diethoxyphenyl)acetyl]-5,5-dimethyl-3-propyliminocyclohexan-1-one.
| Compound Name | 2-[2-(3,4-diethoxyphenyl)acetyl]-5,5-dimethyl-3-propyliminocyclohexan-1-one |
|---|---|
| PubChem CID | 7120460 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 2-[2-(3,4-diethoxyphenyl)acetyl]-5,5-dimethyl-3-propyliminocyclohexan-1-one |
| SMILES | CCC/N=C1\CC(C)(C)CC(=O)C1C(=O)Cc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C23H33NO4/c1-6-11-24-17-14-23(4,5)15-19(26)22(17)18(25)12-16-9-10-20(27-7-2)21(13-16)28-8-3/h9-10,13,22H,6-8,11-12,14-15H2,1-5H3/b24-17+ |
| InChIKey | QYLXYZVJSZONMP-JJIBRWJFSA-N |
| XLogP | 4.45 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|