C22H31NO5 — CID 7288664
2-[C-[(3,4-diethoxyphenyl)methyl]-N-(2-hydroxyethyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 7288664) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is 2-[C-[(3,4-diethoxyphenyl)methyl]-N-(2-hydroxyethyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[C-[(3,4-diethoxyphenyl)methyl]-N-(2-hydroxyethyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 7288664 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 2-[C-[(3,4-diethoxyphenyl)methyl]-N-(2-hydroxyethyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CCOc1ccc(C/C(=N/CCO)C2C(=O)CC(C)(C)CC2=O)cc1OCC |
| InChI | InChI=1S/C22H31NO5/c1-5-27-19-8-7-15(12-20(19)28-6-2)11-16(23-9-10-24)21-17(25)13-22(3,4)14-18(21)26/h7-8,12,21,24H,5-6,9-11,13-14H2,1-4H3/b23-16- |
| InChIKey | AKCVULKZDMATIR-KQWNVCNZSA-N |
| XLogP | 3.03 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|