About Etintidine Hydrochloride
Etintidine Hydrochloride (PubChem CID 135413502) has the molecular formula C12H17ClN6S
and a molecular weight of 312.82 g/mol. Its IUPAC name is 1-cyano-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-3-prop-2-ynylguanidine;hydrochloride.
Molecular Properties
| Compound Name | Etintidine Hydrochloride |
| PubChem CID | 135413502 |
| Molecular Formula | C12H17ClN6S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-cyano-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-3-prop-2-ynylguanidine;hydrochloride |
| SMILES | CC1=C(N=CN1)CSCCN=C(NCC#C)NC#N.Cl |
| InChI | InChI=1S/C12H16N6S.ClH/c1-3-4-14-12(16-8-13)15-5-6-19-7-11-10(2)17-9-18-11;/h1,9H,4-7H2,2H3,(H,17,18)(H2,14,15,16);1H |
| InChIKey | BHEZOMBVJJYAFT-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 114.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | 390 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze Etintidine Hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Etintidine Hydrochloride?
The IUPAC name of Etintidine Hydrochloride (CID 135413502) is 1-cyano-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-3-prop-2-ynylguanidine;hydrochloride.
What is the SMILES notation for Etintidine Hydrochloride?
The canonical SMILES for Etintidine Hydrochloride is CC1=C(N=CN1)CSCCN=C(NCC#C)NC#N.Cl.
What is the InChIKey of Etintidine Hydrochloride?
The InChIKey is BHEZOMBVJJYAFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N6S.ClH/c1-3-4-14-12(16-8-13)15-5-6-19-7-11-10(2)17-9-18-11;/h1,9H,4-7H2,2H3,(H,17,18)(H2,14,15,16);1H.
What are the key properties of Etintidine Hydrochloride?
Etintidine Hydrochloride has a molecular weight of 312.82 g/mol, XLogP of not available, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Etintidine Hydrochloride is sourced from PubChem (CID 135413502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).