C12H16N6S — CID 135413503
Etintidine (PubChem CID 135413503) has the molecular formula C12H16N6S and a molecular weight of 276.36 g/mol. Its IUPAC name is 1-cyano-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-3-prop-2-ynylguanidine.
| Compound Name | Etintidine |
|---|---|
| PubChem CID | 135413503 |
| Molecular Formula | C12H16N6S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-cyano-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-3-prop-2-ynylguanidine |
| SMILES | CC1=C(N=CN1)CSCCN=C(NCC#C)NC#N |
| InChI | InChI=1S/C12H16N6S/c1-3-4-14-12(16-8-13)15-5-6-19-7-11-10(2)17-9-18-11/h1,9H,4-7H2,2H3,(H,17,18)(H2,14,15,16) |
| InChIKey | KEDVUOWPLAHMLZ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | 390 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|