About Cimetidine sulfoxide
Cimetidine sulfoxide (PubChem CID 62949) has the molecular formula C10H16N6OS
and a molecular weight of 268.34 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfinyl]ethyl]guanidine.
Molecular Properties
| Compound Name | Cimetidine sulfoxide |
| PubChem CID | 62949 |
| Molecular Formula | C10H16N6OS |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-cyano-2-methyl-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfinyl]ethyl]guanidine |
| SMILES | CC1=C(N=CN1)CS(=O)CCNC(=NC)NC#N |
| InChI | InChI=1S/C10H16N6OS/c1-8-9(16-7-15-8)5-18(17)4-3-13-10(12-2)14-6-11/h7H,3-5H2,1-2H3,(H,15,16)(H2,12,13,14) |
| InChIKey | HOJLJLYVNQFCRE-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | 363 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze Cimetidine sulfoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cimetidine sulfoxide?
The IUPAC name of Cimetidine sulfoxide (CID 62949) is 1-cyano-2-methyl-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfinyl]ethyl]guanidine.
What is the SMILES notation for Cimetidine sulfoxide?
The canonical SMILES for Cimetidine sulfoxide is CC1=C(N=CN1)CS(=O)CCNC(=NC)NC#N.
What is the InChIKey of Cimetidine sulfoxide?
The InChIKey is HOJLJLYVNQFCRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N6OS/c1-8-9(16-7-15-8)5-18(17)4-3-13-10(12-2)14-6-11/h7H,3-5H2,1-2H3,(H,15,16)(H2,12,13,14).
What are the key properties of Cimetidine sulfoxide?
Cimetidine sulfoxide has a molecular weight of 268.34 g/mol, XLogP of -1.10, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Cimetidine sulfoxide is sourced from PubChem (CID 62949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).