C27H23Cl2N7O4 — CID 135415259
1-acetyl-6-[5-[1-acetyl-3-(4-chlorophenyl)-5-oxo-4,6-dihydro-1,2,4-triazin-6-yl]-1-methylpyrrol-2-yl]-3-(4-chlorophenyl)-4,6-dihydro-1,2,4-triazin-5-one (PubChem CID 135415259) has the molecular formula C27H23Cl2N7O4 and a molecular weight of 580.43 g/mol. Its IUPAC name is 1-acetyl-6-[5-[1-acetyl-3-(4-chlorophenyl)-5-oxo-4,6-dihydro-1,2,4-triazin-6-yl]-1-methylpyrrol-2-yl]-3-(4-chlorophenyl)-4,6-dihydro-1,2,4-triazin-5-one.
| Compound Name | 1-acetyl-6-[5-[1-acetyl-3-(4-chlorophenyl)-5-oxo-4,6-dihydro-1,2,4-triazin-6-yl]-1-methylpyrrol-2-yl]-3-(4-chlorophenyl)-4,6-dihydro-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135415259 |
| Molecular Formula | C27H23Cl2N7O4 |
| Molecular Weight | 580.43 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | 1-acetyl-6-[5-[1-acetyl-3-(4-chlorophenyl)-5-oxo-4,6-dihydro-1,2,4-triazin-6-yl]-1-methylpyrrol-2-yl]-3-(4-chlorophenyl)-4,6-dihydro-1,2,4-triazin-5-one |
| SMILES | CC(=O)N1N=C(c2ccc(Cl)cc2)NC(=O)C1c1ccc(C2C(=O)NC(c3ccc(Cl)cc3)=NN2C(C)=O)n1C |
| InChI | InChI=1S/C27H23Cl2N7O4/c1-14(37)35-22(26(39)30-24(32-35)16-4-8-18(28)9-5-16)20-12-13-21(34(20)3)23-27(40)31-25(33-36(23)15(2)38)17-6-10-19(29)11-7-17/h4-13,22-23H,1-3H3,(H,30,32,39)(H,31,33,40) |
| InChIKey | JDQYHOYHXVUDMD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 128.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |