C15H12ClN3O — CID 625219
3-(4-chlorophenyl)-5-phenyl-2,5-dihydro-1H-1,2,4-triazin-6-one (PubChem CID 625219) has the molecular formula C15H12ClN3O and a molecular weight of 285.73 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-phenyl-2,5-dihydro-1H-1,2,4-triazin-6-one.
| Compound Name | 3-(4-chlorophenyl)-5-phenyl-2,5-dihydro-1H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 625219 |
| Molecular Formula | C15H12ClN3O |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 3-(4-chlorophenyl)-5-phenyl-2,5-dihydro-1H-1,2,4-triazin-6-one |
| SMILES | O=C1NNC(c2ccc(Cl)cc2)=NC1c1ccccc1 |
| InChI | InChI=1S/C15H12ClN3O/c16-12-8-6-11(7-9-12)14-17-13(15(20)19-18-14)10-4-2-1-3-5-10/h1-9,13H,(H,17,18)(H,19,20) |
| InChIKey | SYMTYYWKWANFBB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |