C17H14N2O3 — CID 100975270
6-oxo-2,4-diphenyl-4,5-dihydro-1H-pyrimidine-5-carboxylic acid (PubChem CID 100975270) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 6-oxo-2,4-diphenyl-4,5-dihydro-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 6-oxo-2,4-diphenyl-4,5-dihydro-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 100975270 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 6-oxo-2,4-diphenyl-4,5-dihydro-1H-pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)C1C(=O)NC(c2ccccc2)=NC1c1ccccc1 |
| InChI | InChI=1S/C17H14N2O3/c20-16-13(17(21)22)14(11-7-3-1-4-8-11)18-15(19-16)12-9-5-2-6-10-12/h1-10,13-14H,(H,21,22)(H,18,19,20) |
| InChIKey | YBUKAOQXUMXFJD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|