C21H16Cl2N2O2S — CID 175807875
5-(4-chlorophenyl)-2-(4-chlorophenyl)sulfonyl-4-deuterio-4-phenyl-3H-pyrazole (PubChem CID 175807875) has the molecular formula C21H16Cl2N2O2S and a molecular weight of 432.35 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-(4-chlorophenyl)sulfonyl-4-deuterio-4-phenyl-3H-pyrazole.
| Compound Name | 5-(4-chlorophenyl)-2-(4-chlorophenyl)sulfonyl-4-deuterio-4-phenyl-3H-pyrazole |
|---|---|
| PubChem CID | 175807875 |
| Molecular Formula | C21H16Cl2N2O2S |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 5-(4-chlorophenyl)-2-(4-chlorophenyl)sulfonyl-4-deuterio-4-phenyl-3H-pyrazole |
| SMILES | [2H]C1(c2ccccc2)CN(S(=O)(=O)c2ccc(Cl)cc2)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16Cl2N2O2S/c22-17-8-6-16(7-9-17)21-20(15-4-2-1-3-5-15)14-25(24-21)28(26,27)19-12-10-18(23)11-13-19/h1-13,20H,14H2/i20D |
| InChIKey | ZDNWUJAEORZCRN-YVHRXSIGSA-N |
| XLogP | 5.19 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |