C23H20Cl3N3O2S — CID 11634852
4-[(4S)-2-(4-chlorophenyl)sulfonyl-5-(3,4-dichlorophenyl)-3,4-dihydropyrazol-4-yl]-N,N-dimethylaniline (PubChem CID 11634852) has the molecular formula C23H20Cl3N3O2S and a molecular weight of 508.86 g/mol. Its IUPAC name is 4-[(4S)-2-(4-chlorophenyl)sulfonyl-5-(3,4-dichlorophenyl)-3,4-dihydropyrazol-4-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(4S)-2-(4-chlorophenyl)sulfonyl-5-(3,4-dichlorophenyl)-3,4-dihydropyrazol-4-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 11634852 |
| Molecular Formula | C23H20Cl3N3O2S |
| Molecular Weight | 508.86 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | 4-[(4S)-2-(4-chlorophenyl)sulfonyl-5-(3,4-dichlorophenyl)-3,4-dihydropyrazol-4-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([C@H]2CN(S(=O)(=O)c3ccc(Cl)cc3)N=C2c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C23H20Cl3N3O2S/c1-28(2)18-8-3-15(4-9-18)20-14-29(32(30,31)19-10-6-17(24)7-11-19)27-23(20)16-5-12-21(25)22(26)13-16/h3-13,20H,14H2,1-2H3/t20-/m1/s1 |
| InChIKey | YYFWMWSMLYGHCD-HXUWFJFHSA-N |
| XLogP | 5.91 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.86 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|