C17H11Cl2NO2 — CID 14293688
3-(3-chlorophenyl)-4-(4-chlorophenyl)-3H-pyridine-2,6-dione (PubChem CID 14293688) has the molecular formula C17H11Cl2NO2 and a molecular weight of 332.19 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-4-(4-chlorophenyl)-3H-pyridine-2,6-dione.
| Compound Name | 3-(3-chlorophenyl)-4-(4-chlorophenyl)-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 14293688 |
| Molecular Formula | C17H11Cl2NO2 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 3-(3-chlorophenyl)-4-(4-chlorophenyl)-3H-pyridine-2,6-dione |
| SMILES | O=C1C=C(c2ccc(Cl)cc2)C(c2cccc(Cl)c2)C(=O)N1 |
| InChI | InChI=1S/C17H11Cl2NO2/c18-12-6-4-10(5-7-12)14-9-15(21)20-17(22)16(14)11-2-1-3-13(19)8-11/h1-9,16H,(H,20,21,22) |
| InChIKey | UIGIMQNGXSCMCW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|