C25H20N4O2 — CID 135589728
(6S)-1-benzoyl-6-(1-methylindol-3-yl)-3-phenyl-4,6-dihydro-1,2,4-triazin-5-one (PubChem CID 135589728) has the molecular formula C25H20N4O2 and a molecular weight of 408.46 g/mol. Its IUPAC name is (6S)-1-benzoyl-6-(1-methylindol-3-yl)-3-phenyl-4,6-dihydro-1,2,4-triazin-5-one.
| Compound Name | (6S)-1-benzoyl-6-(1-methylindol-3-yl)-3-phenyl-4,6-dihydro-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135589728 |
| Molecular Formula | C25H20N4O2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (6S)-1-benzoyl-6-(1-methylindol-3-yl)-3-phenyl-4,6-dihydro-1,2,4-triazin-5-one |
| SMILES | Cn1cc([C@H]2C(=O)NC(c3ccccc3)=NN2C(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H20N4O2/c1-28-16-20(19-14-8-9-15-21(19)28)22-24(30)26-23(17-10-4-2-5-11-17)27-29(22)25(31)18-12-6-3-7-13-18/h2-16,22H,1H3,(H,26,27,30)/t22-/m0/s1 |
| InChIKey | JJWYXHWYBWDXCK-QFIPXVFZSA-N |
| XLogP | 3.85 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |