C19H16N4O2 — CID 135737693
(6R)-6-(1-methylindol-3-yl)-5-oxo-3-phenyl-4,6-dihydro-1,2,4-triazine-1-carbaldehyde (PubChem CID 135737693) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is (6R)-6-(1-methylindol-3-yl)-5-oxo-3-phenyl-4,6-dihydro-1,2,4-triazine-1-carbaldehyde.
| Compound Name | (6R)-6-(1-methylindol-3-yl)-5-oxo-3-phenyl-4,6-dihydro-1,2,4-triazine-1-carbaldehyde |
|---|---|
| PubChem CID | 135737693 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (6R)-6-(1-methylindol-3-yl)-5-oxo-3-phenyl-4,6-dihydro-1,2,4-triazine-1-carbaldehyde |
| SMILES | Cn1cc([C@@H]2C(=O)NC(c3ccccc3)=NN2C=O)c2ccccc21 |
| InChI | InChI=1S/C19H16N4O2/c1-22-11-15(14-9-5-6-10-16(14)22)17-19(25)20-18(21-23(17)12-24)13-7-3-2-4-8-13/h2-12,17H,1H3,(H,20,21,25)/t17-/m1/s1 |
| InChIKey | JCPNQHQKFCCSOL-QGZVFWFLSA-N |
| XLogP | 2.17 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|