C24H19N3O3S2 — CID 51566042
(1S,8R,9S)-4-benzyl-8-(1-methylindol-3-yl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 51566042) has the molecular formula C24H19N3O3S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is (1S,8R,9S)-4-benzyl-8-(1-methylindol-3-yl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1S,8R,9S)-4-benzyl-8-(1-methylindol-3-yl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 51566042 |
| Molecular Formula | C24H19N3O3S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | (1S,8R,9S)-4-benzyl-8-(1-methylindol-3-yl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | Cn1cc([C@@H]2c3sc(=O)n(Cc4ccccc4)c3S[C@@H]3C(=O)NC(=O)[C@H]23)c2ccccc21 |
| InChI | InChI=1S/C24H19N3O3S2/c1-26-12-15(14-9-5-6-10-16(14)26)17-18-19(22(29)25-21(18)28)31-23-20(17)32-24(30)27(23)11-13-7-3-2-4-8-13/h2-10,12,17-19H,11H2,1H3,(H,25,28,29)/t17-,18+,19-/m0/s1 |
| InChIKey | OJMSHOCEXTXPRC-OTWHNJEPSA-N |
| XLogP | 3.33 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|