C44H32N4O3 — CID 135415841
2-(4-methoxyphenyl)-5-[8-[2-(4-methoxyphenyl)-4-phenyl-1H-imidazol-5-yl]dibenzofuran-2-yl]-4-phenyl-1H-imidazole (PubChem CID 135415841) has the molecular formula C44H32N4O3 and a molecular weight of 664.77 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-[8-[2-(4-methoxyphenyl)-4-phenyl-1H-imidazol-5-yl]dibenzofuran-2-yl]-4-phenyl-1H-imidazole.
| Compound Name | 2-(4-methoxyphenyl)-5-[8-[2-(4-methoxyphenyl)-4-phenyl-1H-imidazol-5-yl]dibenzofuran-2-yl]-4-phenyl-1H-imidazole |
|---|---|
| PubChem CID | 135415841 |
| Molecular Formula | C44H32N4O3 |
| Molecular Weight | 664.77 g/mol |
| Exact Mass | 664.25 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-[8-[2-(4-methoxyphenyl)-4-phenyl-1H-imidazol-5-yl]dibenzofuran-2-yl]-4-phenyl-1H-imidazole |
| SMILES | COc1ccc(-c2nc(-c3ccccc3)c(-c3ccc4oc5ccc(-c6[nH]c(-c7ccc(OC)cc7)nc6-c6ccccc6)cc5c4c3)[nH]2)cc1 |
| InChI | InChI=1S/C44H32N4O3/c1-49-33-19-13-29(14-20-33)43-45-39(27-9-5-3-6-10-27)41(47-43)31-17-23-37-35(25-31)36-26-32(18-24-38(36)51-37)42-40(28-11-7-4-8-12-28)46-44(48-42)30-15-21-34(50-2)22-16-30/h3-26H,1-2H3,(H,45,47)(H,46,48) |
| InChIKey | XWHBBKYZURKRTE-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.77 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|