C19H23N3OS — CID 135416801
methyl N-(4-pentylbenzoyl)-N'-pyridin-3-ylcarbamimidothioate (PubChem CID 135416801) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is methyl N-(4-pentylbenzoyl)-N'-pyridin-3-ylcarbamimidothioate.
| Compound Name | methyl N-(4-pentylbenzoyl)-N'-pyridin-3-ylcarbamimidothioate |
|---|---|
| PubChem CID | 135416801 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | methyl N-(4-pentylbenzoyl)-N'-pyridin-3-ylcarbamimidothioate |
| SMILES | CCCCCc1ccc(C(=O)N/C(=N/c2cccnc2)SC)cc1 |
| InChI | InChI=1S/C19H23N3OS/c1-3-4-5-7-15-9-11-16(12-10-15)18(23)22-19(24-2)21-17-8-6-13-20-14-17/h6,8-14H,3-5,7H2,1-2H3,(H,21,22,23) |
| InChIKey | NIJYKLRPTMFXFD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|