C16H11NO3 — CID 135419063
3-[(Z)-2-hydroxy-2-phenylethenyl]-1,4-benzoxazin-2-one (PubChem CID 135419063) has the molecular formula C16H11NO3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 3-[(Z)-2-hydroxy-2-phenylethenyl]-1,4-benzoxazin-2-one.
| Compound Name | 3-[(Z)-2-hydroxy-2-phenylethenyl]-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 135419063 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3-[(Z)-2-hydroxy-2-phenylethenyl]-1,4-benzoxazin-2-one |
| SMILES | O=c1oc2ccccc2nc1/C=C(\O)c1ccccc1 |
| InChI | InChI=1S/C16H11NO3/c18-14(11-6-2-1-3-7-11)10-13-16(19)20-15-9-5-4-8-12(15)17-13/h1-10,18H/b14-10- |
| InChIKey | KDNJHCOMTTUDDG-UVTDQMKNSA-N |
| XLogP | 3.24 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|