C16H10BrNO3 — CID 135421120
3-[(Z)-2-(4-bromophenyl)-2-hydroxyethenyl]-1,4-benzoxazin-2-one (PubChem CID 135421120) has the molecular formula C16H10BrNO3 and a molecular weight of 344.16 g/mol. Its IUPAC name is 3-[(Z)-2-(4-bromophenyl)-2-hydroxyethenyl]-1,4-benzoxazin-2-one.
| Compound Name | 3-[(Z)-2-(4-bromophenyl)-2-hydroxyethenyl]-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 135421120 |
| Molecular Formula | C16H10BrNO3 |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 3-[(Z)-2-(4-bromophenyl)-2-hydroxyethenyl]-1,4-benzoxazin-2-one |
| SMILES | O=c1oc2ccccc2nc1/C=C(\O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H10BrNO3/c17-11-7-5-10(6-8-11)14(19)9-13-16(20)21-15-4-2-1-3-12(15)18-13/h1-9,19H/b14-9- |
| InChIKey | AXBWKAORGRMYJD-ZROIWOOFSA-N |
| XLogP | 4.01 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|