C18H12FNO3 — CID 135451172
3-[(1Z,3E)-4-(4-fluorophenyl)-2-hydroxybuta-1,3-dienyl]-1,4-benzoxazin-2-one (PubChem CID 135451172) has the molecular formula C18H12FNO3 and a molecular weight of 309.30 g/mol. Its IUPAC name is 3-[(1Z,3E)-4-(4-fluorophenyl)-2-hydroxybuta-1,3-dienyl]-1,4-benzoxazin-2-one.
| Compound Name | 3-[(1Z,3E)-4-(4-fluorophenyl)-2-hydroxybuta-1,3-dienyl]-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 135451172 |
| Molecular Formula | C18H12FNO3 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 3-[(1Z,3E)-4-(4-fluorophenyl)-2-hydroxybuta-1,3-dienyl]-1,4-benzoxazin-2-one |
| SMILES | O=c1oc2ccccc2nc1/C=C(O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C18H12FNO3/c19-13-8-5-12(6-9-13)7-10-14(21)11-16-18(22)23-17-4-2-1-3-15(17)20-16/h1-11,21H/b10-7+,14-11- |
| InChIKey | IIPJPUJXHJMBLM-KSMSJBKCSA-N |
| XLogP | 3.94 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|