C20H16N4O3S — CID 135423055
4-[(2-hydroxy-5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methylideneamino]benzenesulfonamide (PubChem CID 135423055) has the molecular formula C20H16N4O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is 4-[(2-hydroxy-5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methylideneamino]benzenesulfonamide.
| Compound Name | 4-[(2-hydroxy-5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 135423055 |
| Molecular Formula | C20H16N4O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 4-[(2-hydroxy-5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methylideneamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=C/c2c(O)[nH]c3ncc(-c4ccccc4)cc23)cc1 |
| InChI | InChI=1S/C20H16N4O3S/c21-28(26,27)16-8-6-15(7-9-16)22-12-18-17-10-14(13-4-2-1-3-5-13)11-23-19(17)24-20(18)25/h1-12,25H,(H,23,24)(H2,21,26,27)/b22-12+ |
| InChIKey | OSIPEVIAEIKIOW-WSDLNYQXSA-N |
| XLogP | 3.33 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|