C18H17N3O4 — CID 135800763
ethyl 2-hydroxy-3-[[3-(hydroxymethyl)phenyl]iminomethyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (PubChem CID 135800763) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is ethyl 2-hydroxy-3-[[3-(hydroxymethyl)phenyl]iminomethyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate.
| Compound Name | ethyl 2-hydroxy-3-[[3-(hydroxymethyl)phenyl]iminomethyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 135800763 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | ethyl 2-hydroxy-3-[[3-(hydroxymethyl)phenyl]iminomethyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc2[nH]c(O)c(/C=N/c3cccc(CO)c3)c2c1 |
| InChI | InChI=1S/C18H17N3O4/c1-2-25-18(24)12-7-14-15(17(23)21-16(14)20-8-12)9-19-13-5-3-4-11(6-13)10-22/h3-9,22-23H,2,10H2,1H3,(H,20,21)/b19-9+ |
| InChIKey | QXSJDBXOFLVARS-DJKKODMXSA-N |
| XLogP | 2.69 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|