C19H12N4O4S — CID 135423708
4-hydroxy-6-methyl-3-(6-phenylimino-[1,2,4]thiadiazolo[3,2-b][1,3,4]oxadiazol-2-yl)chromen-2-one (PubChem CID 135423708) has the molecular formula C19H12N4O4S and a molecular weight of 392.40 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-3-(6-phenylimino-[1,2,4]thiadiazolo[3,2-b][1,3,4]oxadiazol-2-yl)chromen-2-one.
| Compound Name | 4-hydroxy-6-methyl-3-(6-phenylimino-[1,2,4]thiadiazolo[3,2-b][1,3,4]oxadiazol-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 135423708 |
| Molecular Formula | C19H12N4O4S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 4-hydroxy-6-methyl-3-(6-phenylimino-[1,2,4]thiadiazolo[3,2-b][1,3,4]oxadiazol-2-yl)chromen-2-one |
| SMILES | Cc1ccc2oc(=O)c(-c3nn4s/c(=N\c5ccccc5)nc4o3)c(O)c2c1 |
| InChI | InChI=1S/C19H12N4O4S/c1-10-7-8-13-12(9-10)15(24)14(17(25)26-13)16-22-23-19(27-16)21-18(28-23)20-11-5-3-2-4-6-11/h2-9,24H,1H3/b20-18- |
| InChIKey | IOPJOXLIHOHMMX-ZZEZOPTASA-N |
| XLogP | 3.40 |
| TPSA | 106.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|