C8H8N4OS — CID 135424359
2-ethylsulfanyl-6H-pyrimido[4,5-d]pyrimidin-5-one (PubChem CID 135424359) has the molecular formula C8H8N4OS and a molecular weight of 208.25 g/mol. Its IUPAC name is 2-ethylsulfanyl-6H-pyrimido[4,5-d]pyrimidin-5-one.
| Compound Name | 2-ethylsulfanyl-6H-pyrimido[4,5-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 135424359 |
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 2-ethylsulfanyl-6H-pyrimido[4,5-d]pyrimidin-5-one |
| SMILES | CCSc1ncc2c(=O)[nH]cnc2n1 |
| InChI | InChI=1S/C8H8N4OS/c1-2-14-8-9-3-5-6(12-8)10-4-11-7(5)13/h3-4H,2H2,1H3,(H,9,10,11,12,13) |
| InChIKey | BNSLMVACZAPEMC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |