C11H16N4OS — CID 72932963
2-(ethylamino)-N-(thiolan-3-yl)pyrimidine-5-carboxamide (PubChem CID 72932963) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-(ethylamino)-N-(thiolan-3-yl)pyrimidine-5-carboxamide.
| Compound Name | 2-(ethylamino)-N-(thiolan-3-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 72932963 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-(ethylamino)-N-(thiolan-3-yl)pyrimidine-5-carboxamide |
| SMILES | CCNc1ncc(C(=O)NC2CCSC2)cn1 |
| InChI | InChI=1S/C11H16N4OS/c1-2-12-11-13-5-8(6-14-11)10(16)15-9-3-4-17-7-9/h5-6,9H,2-4,7H2,1H3,(H,15,16)(H,12,13,14) |
| InChIKey | PZOZINSJDGMIPV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |