C24H25N5O — CID 135426618
N-[[[4-(dimethylamino)phenyl]-[(4-methylphenyl)diazenyl]methylidene]amino]-4-methylbenzamide (PubChem CID 135426618) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is N-[[[4-(dimethylamino)phenyl]-[(4-methylphenyl)diazenyl]methylidene]amino]-4-methylbenzamide.
| Compound Name | N-[[[4-(dimethylamino)phenyl]-[(4-methylphenyl)diazenyl]methylidene]amino]-4-methylbenzamide |
|---|---|
| PubChem CID | 135426618 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-[[[4-(dimethylamino)phenyl]-[(4-methylphenyl)diazenyl]methylidene]amino]-4-methylbenzamide |
| SMILES | Cc1ccc(/N=N/C(=NNC(=O)c2ccc(C)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H25N5O/c1-17-5-9-20(10-6-17)24(30)28-27-23(19-11-15-22(16-12-19)29(3)4)26-25-21-13-7-18(2)8-14-21/h5-16H,1-4H3,(H,28,30)/b26-25+,27-23? |
| InChIKey | DKULMVZYSRSXNH-DMXSXOGMSA-N |
| XLogP | 5.24 |
| TPSA | 69.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|