C24H25N5O2 — CID 136502259
N-[(E)-[[4-(dimethylamino)phenyl]-[(4-methoxyphenyl)diazenyl]methylidene]amino]-4-methylbenzamide (PubChem CID 136502259) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is N-[(E)-[[4-(dimethylamino)phenyl]-[(4-methoxyphenyl)diazenyl]methylidene]amino]-4-methylbenzamide.
| Compound Name | N-[(E)-[[4-(dimethylamino)phenyl]-[(4-methoxyphenyl)diazenyl]methylidene]amino]-4-methylbenzamide |
|---|---|
| PubChem CID | 136502259 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-[(E)-[[4-(dimethylamino)phenyl]-[(4-methoxyphenyl)diazenyl]methylidene]amino]-4-methylbenzamide |
| SMILES | COc1ccc(/N=N/C(=N/NC(=O)c2ccc(C)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H25N5O2/c1-17-5-7-19(8-6-17)24(30)28-27-23(18-9-13-21(14-10-18)29(2)3)26-25-20-11-15-22(31-4)16-12-20/h5-16H,1-4H3,(H,28,30)/b26-25+,27-23+ |
| InChIKey | FAOHROBJSWOSPK-QBRFHGNMSA-N |
| XLogP | 4.95 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|